ChemNet > CAS > 39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
termék neve |
Benzo[b]thiophene-2-carbonyl chloride |
Angol név |
Benzo[b]thiophene-2-carbonyl chloride; Thianaphthene-2-carbonyl chloride; 1-benzothiophene-2-carbonyl chloride |
MF |
C9H5ClOS |
Molekulatömeg |
196.6534 |
InChI |
InChI=1/C9H5ClOS/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H |
CAS-szám |
39827-11-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.41g/cm3 |
Olvadáspont |
85℃ |
Forráspont |
309.5°C at 760 mmHg |
Törésmutató |
1.68 |
Gyulladáspont |
141°C |
Gőznyomás |
0.000636mmHg at 25°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|